Pigment yellow 65 – Corimax Yellow RN
Teknikal na mga parameter ng pigment dilaw 65
| Kulay ng Index Blg. | Bulaklak dilaw 65 |
| Pangalan ng Produkto | Corimax Dilaw na RN |
| Kategorya ng Produkto | Organikong Pigment |
| Numero ng CAS | 6528-34-3 |
| Numero ng EU | 229-419-9 |
| Pamilyang Chemical | Monazo |
| Timbang ng Molekular | 386.36 |
| Molekular na Formula | C18H18N4O6 |
| Halaga ng PH | 6.0-7.0 |
| Density | 1.6 |
| Pagsipsip ng Langis (ml / 100g)% | 35-45 |
| Banayad na Bilis (patong) | 7 |
| Ang paglaban sa init (patong) | 140 |
| Paglaban ng tubig | 5 |
| Paglaban ng langis | 3 |
| Paglaban sa Acid | 5 |
| Paglaban sa Alkali | 5 |
Kulay | ![]() |
| Pamamahagi ng hue |
Mga Tampok: Magandang pagkalat.
Application:
Inirerekumenda para sa mga coatings ng arkitektura, pang-industriya coatings.
Kaugnay na Impormasyon
Pigment Yellow 65 is a high-performance, bright yellow pigment widely used in coatings, inks, plastics, and paints. It offers excellent lightfastness, weather resistance, and chemical stability, making it suitable for both indoor and outdoor applications. Known for its vibrant, clean yellow hue, it provides strong color strength and opacity, ensuring high-quality results. Pigment Yellow 65 is particularly popular in automotive coatings, printing inks, and industrial applications where durability and consistency are crucial. With its non-toxic and environmentally friendly properties, it is a reliable choice for manufacturers seeking long-lasting and vivid yellow colors.
Molekular na Istraktura:
Molekular na Pormula: C18H18N4O6
Timbang ng Molekular: 386.36
Numero ng Registry ng CAS: 6528-34-3
Mga Paraan ng Paggawa: 4-Methoxy-2-nitrobenzenamine diazotization, at N- (2-methoxyphenyl) -3-oxobutanamide pagkabit.
Mga Katangian at Aplikasyon: maliwanag na pulang ilaw dilaw. Pulang pulbos. Ang bilis ng sikat ng araw ay mas mahusay. Ang paglaban sa Cellosole, kerosene, ay hindi makayanan o matiis ang xylene, acid-proof alkaline na mas mahusay. Sa madulas na daluyan, lalo na sa latex coating na ginagamit, maaari ding magamit para sa pangkulay, goma, pangkultura at pang-edukasyon pangkulay.
Structural Identifiers
IUPAC Name: 2-[(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide
SMILES: COC1=CC(=C(C=C1)N=NC(C(C)=O)C(=O)NC1=C(OC)C=CC=C1)[N+]([O-])=O
InChI String: InChI=1/C18H18N4O6/c1-11(23)17(18(24)19-14-6-4-5-7-16(14)28-3)21-20-13-9-8-12(27-2)10-15(13)22(25)26/h4-10,17H,1-3H3,(H,19,24)
InChIKey: UFORAEIAYCSGCR-UHFFFAOYSA-N
Mga kasingkahulugan
| 6528-34-3 |
| Permanent Yellow Rn |
| YELLOW65 |
| 2-[(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide |
| Butanamide,2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-((4-methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxo- |
| Butanamide, 2-[(4-methoxy-2-nitrophenyl)azo]-N-(2-methoxyphenyl)-3-oxo- |
| 2-[2-(4-METHOXY-2-NITROPHENYL)DIAZEN-1-YL]-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE |
| EINECS 229-419-9 |
| EC 229-419-9 |
| SCHEMBL6928762 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-o-acetoacetanisidide |
| DTXSID0052336 |
| SCHEMBL12760851 |
| UFORAEIAYCSGCR-UHFFFAOYSA-N |
| HY-D1204 |
| MFCD00071941 |
| AKOS037643608 |
| Butanamide, 2-(2-(4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxo- |
| AS-17500 |
| CS-0143082 |
| NS00003477 |
| EN300-207584 |
| 2-((4-Methoxy-2-nitrophenyl)azo)-N-(2-methoxyphenyl)-3-oxobutyramide |
| (E)-2-((4-methoxy-2-nitrophenyl)diazenyl)-N-(2-methoxyphenyl)-3-oxobutanamide |
Mga Computed Properties
| Pangalan ng Ari-arian | Halaga ng ari-arian |
| Timbang ng Molekular | 386.4 g/mol |
| XLogP3-AA | 3.3 |
| Bilang ng Donor ng Hydrogen Bond | 1 |
| Bilang ng Tanggap ng Hydrogen Bond | 8 |
| Naiikot na Bilang ng Bono | 7 |
| Eksaktong Misa | 386.12263431 Da |
| Monoisotopic na Misa | 386.12263431 Da |
| Topological Polar Surface Area | 135 Ų |
| Mabibigat na Bilang ng Atom | 28 |
| Pormal na Pagsingil | 0 |
| Pagiging kumplikado | 593 |
| Bilang ng Isotope Atom | 0 |
| Tinukoy na Bilang ng Stereocenter ng Atom | 0 |
| Hindi Natukoy na Bilang ng Stereocenter ng Atom | 1 |
| Tinukoy na Bilang ng Stereocenter ng Bond | 0 |
| Hindi Natukoy na Bilang ng Stereocenter ng Bond | 0 |
| Covalently-Bonded Unit Count | 1 |
| Ang Compound ay Canonicalized | Oo |











